C21H11Cl2F2NO5 — CID 18970709
2-(2,6-dichloroanilino)-1,4-difluoro-5,8-dihydroxy-3-methoxyanthracene-9,10-dione (PubChem CID 18970709) has the molecular formula C21H11Cl2F2NO5 and a molecular weight of 466.22 g/mol. Its IUPAC name is 2-(2,6-dichloroanilino)-1,4-difluoro-5,8-dihydroxy-3-methoxyanthracene-9,10-dione.
| Compound Name | 2-(2,6-dichloroanilino)-1,4-difluoro-5,8-dihydroxy-3-methoxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 18970709 |
| Molecular Formula | C21H11Cl2F2NO5 |
| Molecular Weight | 466.22 g/mol |
| Exact Mass | 465.00 |
| IUPAC Name | 2-(2,6-dichloroanilino)-1,4-difluoro-5,8-dihydroxy-3-methoxyanthracene-9,10-dione |
| SMILES | COc1c(F)c2c(c(F)c1Nc1c(Cl)cccc1Cl)C(=O)c1c(O)ccc(O)c1C2=O |
| InChI | InChI=1S/C21H11Cl2F2NO5/c1-31-21-16(25)14-13(15(24)18(21)26-17-7(22)3-2-4-8(17)23)19(29)11-9(27)5-6-10(28)12(11)20(14)30/h2-6,26-28H,1H3 |
| InChIKey | ZLAQWIYYCHYPQW-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.22 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|