About amino 5-methylhexanoate
amino 5-methylhexanoate (PubChem CID 18970778) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is amino 5-methylhexanoate.
Molecular Properties
| Compound Name | amino 5-methylhexanoate |
| PubChem CID | 18970778 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | amino 5-methylhexanoate |
| SMILES | CC(C)CCCC(=O)ON |
| InChI | InChI=1S/C7H15NO2/c1-6(2)4-3-5-7(9)10-8/h6H,3-5,8H2,1-2H3 |
| InChIKey | XLIXTGZAVQUWEK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino 5-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino 5-methylhexanoate?
The IUPAC name of amino 5-methylhexanoate (CID 18970778) is amino 5-methylhexanoate.
What is the SMILES notation for amino 5-methylhexanoate?
The canonical SMILES for amino 5-methylhexanoate is CC(C)CCCC(=O)ON.
What is the InChIKey of amino 5-methylhexanoate?
The InChIKey is XLIXTGZAVQUWEK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2/c1-6(2)4-3-5-7(9)10-8/h6H,3-5,8H2,1-2H3.
What are the key properties of amino 5-methylhexanoate?
amino 5-methylhexanoate has a molecular weight of 145.20 g/mol, XLogP of 1.23, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for amino 5-methylhexanoate is sourced from PubChem (CID 18970778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).