C52H60N2O9S — CID 18970847
N-[7-[3-[1-[1-(benzenesulfonyl)indol-3-yl]ethoxy]-2-hydroxy-4,5,6-tris(phenylmethoxy)cyclohexyl]oxyheptyl]acetamide (PubChem CID 18970847) has the molecular formula C52H60N2O9S and a molecular weight of 889.12 g/mol. Its IUPAC name is N-[7-[3-[1-[1-(benzenesulfonyl)indol-3-yl]ethoxy]-2-hydroxy-4,5,6-tris(phenylmethoxy)cyclohexyl]oxyheptyl]acetamide.
| Compound Name | N-[7-[3-[1-[1-(benzenesulfonyl)indol-3-yl]ethoxy]-2-hydroxy-4,5,6-tris(phenylmethoxy)cyclohexyl]oxyheptyl]acetamide |
|---|---|
| PubChem CID | 18970847 |
| Molecular Formula | C52H60N2O9S |
| Molecular Weight | 889.12 g/mol |
| Exact Mass | 888.40 |
| IUPAC Name | N-[7-[3-[1-[1-(benzenesulfonyl)indol-3-yl]ethoxy]-2-hydroxy-4,5,6-tris(phenylmethoxy)cyclohexyl]oxyheptyl]acetamide |
| SMILES | CC(=O)NCCCCCCCOC1C(O)C(OC(C)c2cn(S(=O)(=O)c3ccccc3)c3ccccc23)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C52H60N2O9S/c1-38(45-34-54(46-31-19-18-30-44(45)46)64(57,58)43-28-16-9-17-29-43)63-49-47(56)48(59-33-21-5-3-4-20-32-53-39(2)55)50(60-35-40-22-10-6-11-23-40)52(62-37-42-26-14-8-15-27-42)51(49)61-36-41-24-12-7-13-25-41/h6-19,22-31,34,38,47-52,56H,3-5,20-21,32-33,35-37H2,1-2H3,(H,53,55) |
| InChIKey | CCHYFUQLCARWFG-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 134.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.12 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|