About 2-[(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)sulfonyl]benzonitrile
2-[(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)sulfonyl]benzonitrile (PubChem CID 18971468) has the molecular formula C15H8ClN3O4S
and a molecular weight of 361.77 g/mol. Its IUPAC name is 2-[(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)sulfonyl]benzonitrile.
Molecular Properties
| Compound Name | 2-[(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)sulfonyl]benzonitrile |
| PubChem CID | 18971468 |
| Molecular Formula | C15H8ClN3O4S |
| Molecular Weight | 361.77 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 2-[(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)sulfonyl]benzonitrile |
| SMILES | N#Cc1ccccc1S(=O)(=O)n1c(=O)[nH]c2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C15H8ClN3O4S/c16-10-5-6-11-12(7-10)18-15(21)19(14(11)20)24(22,23)13-4-2-1-3-9(13)8-17/h1-7H,(H,18,21) |
| InChIKey | QGDGCZRYNZDDEP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 112.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.77 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)sulfonyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)sulfonyl]benzonitrile?
The IUPAC name of 2-[(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)sulfonyl]benzonitrile (CID 18971468) is 2-[(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)sulfonyl]benzonitrile.
What is the SMILES notation for 2-[(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)sulfonyl]benzonitrile?
The canonical SMILES for 2-[(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)sulfonyl]benzonitrile is N#Cc1ccccc1S(=O)(=O)n1c(=O)[nH]c2cc(Cl)ccc2c1=O.
What is the InChIKey of 2-[(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)sulfonyl]benzonitrile?
The InChIKey is QGDGCZRYNZDDEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H8ClN3O4S/c16-10-5-6-11-12(7-10)18-15(21)19(14(11)20)24(22,23)13-4-2-1-3-9(13)8-17/h1-7H,(H,18,21).
What are the key properties of 2-[(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)sulfonyl]benzonitrile?
2-[(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)sulfonyl]benzonitrile has a molecular weight of 361.77 g/mol, XLogP of 1.45, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(7-chloro-2,4-dioxo-1H-quinazolin-3-yl)sulfonyl]benzonitrile is sourced from PubChem (CID 18971468), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).