About 1-[4-[(tert-butylamino)methyl]cyclohepta[b]indol-7-yl]-3,3-dimethylbutan-1-one;oxalic acid
1-[4-[(tert-butylamino)methyl]cyclohepta[b]indol-7-yl]-3,3-dimethylbutan-1-one;oxalic acid (PubChem CID 18971921) has the molecular formula C26H32N2O5
and a molecular weight of 452.55 g/mol. Its IUPAC name is 1-[4-[(tert-butylamino)methyl]cyclohepta[b]indol-7-yl]-3,3-dimethylbutan-1-one;oxalic acid.
Molecular Properties
| Compound Name | 1-[4-[(tert-butylamino)methyl]cyclohepta[b]indol-7-yl]-3,3-dimethylbutan-1-one;oxalic acid |
| PubChem CID | 18971921 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 1-[4-[(tert-butylamino)methyl]cyclohepta[b]indol-7-yl]-3,3-dimethylbutan-1-one;oxalic acid |
| SMILES | CC(C)(C)CC(=O)c1cccc2c3cccc(CNC(C)(C)C)c3nc-2c1.O=C(O)C(=O)O |
| InChI | InChI=1S/C24H30N2O.C2H2O4/c1-23(2,3)14-21(27)16-9-7-11-18-19-12-8-10-17(15-25-24(4,5)6)22(19)26-20(18)13-16;3-1(4)2(5)6/h7-13,25H,14-15H2,1-6H3;(H,3,4)(H,5,6) |
| InChIKey | KTJHMEWCOPRRRR-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 116.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(tert-butylamino)methyl]cyclohepta[b]indol-7-yl]-3,3-dimethylbutan-1-one;oxalic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(tert-butylamino)methyl]cyclohepta[b]indol-7-yl]-3,3-dimethylbutan-1-one;oxalic acid?
The IUPAC name of 1-[4-[(tert-butylamino)methyl]cyclohepta[b]indol-7-yl]-3,3-dimethylbutan-1-one;oxalic acid (CID 18971921) is 1-[4-[(tert-butylamino)methyl]cyclohepta[b]indol-7-yl]-3,3-dimethylbutan-1-one;oxalic acid.
What is the SMILES notation for 1-[4-[(tert-butylamino)methyl]cyclohepta[b]indol-7-yl]-3,3-dimethylbutan-1-one;oxalic acid?
The canonical SMILES for 1-[4-[(tert-butylamino)methyl]cyclohepta[b]indol-7-yl]-3,3-dimethylbutan-1-one;oxalic acid is CC(C)(C)CC(=O)c1cccc2c3cccc(CNC(C)(C)C)c3nc-2c1.O=C(O)C(=O)O.
What is the InChIKey of 1-[4-[(tert-butylamino)methyl]cyclohepta[b]indol-7-yl]-3,3-dimethylbutan-1-one;oxalic acid?
The InChIKey is KTJHMEWCOPRRRR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N2O.C2H2O4/c1-23(2,3)14-21(27)16-9-7-11-18-19-12-8-10-17(15-25-24(4,5)6)22(19)26-20(18)13-16;3-1(4)2(5)6/h7-13,25H,14-15H2,1-6H3;(H,3,4)(H,5,6).
What are the key properties of 1-[4-[(tert-butylamino)methyl]cyclohepta[b]indol-7-yl]-3,3-dimethylbutan-1-one;oxalic acid?
1-[4-[(tert-butylamino)methyl]cyclohepta[b]indol-7-yl]-3,3-dimethylbutan-1-one;oxalic acid has a molecular weight of 452.55 g/mol, XLogP of 5.00, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(tert-butylamino)methyl]cyclohepta[b]indol-7-yl]-3,3-dimethylbutan-1-one;oxalic acid is sourced from PubChem (CID 18971921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).