About N-(3-aminocyclohexa-1,5-dien-1-yl)acetamide
N-(3-aminocyclohexa-1,5-dien-1-yl)acetamide (PubChem CID 18972254) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is N-(3-aminocyclohexa-1,5-dien-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(3-aminocyclohexa-1,5-dien-1-yl)acetamide |
| PubChem CID | 18972254 |
| Molecular Formula | C8H12N2O |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.09 |
| IUPAC Name | N-(3-aminocyclohexa-1,5-dien-1-yl)acetamide |
| SMILES | CC(=O)NC1=CC(N)CC=C1 |
| InChI | InChI=1S/C8H12N2O/c1-6(11)10-8-4-2-3-7(9)5-8/h2,4-5,7H,3,9H2,1H3,(H,10,11) |
| InChIKey | DDWMTCNGNHNIQL-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3-aminocyclohexa-1,5-dien-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-aminocyclohexa-1,5-dien-1-yl)acetamide?
The IUPAC name of N-(3-aminocyclohexa-1,5-dien-1-yl)acetamide (CID 18972254) is N-(3-aminocyclohexa-1,5-dien-1-yl)acetamide.
What is the SMILES notation for N-(3-aminocyclohexa-1,5-dien-1-yl)acetamide?
The canonical SMILES for N-(3-aminocyclohexa-1,5-dien-1-yl)acetamide is CC(=O)NC1=CC(N)CC=C1.
What is the InChIKey of N-(3-aminocyclohexa-1,5-dien-1-yl)acetamide?
The InChIKey is DDWMTCNGNHNIQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-6(11)10-8-4-2-3-7(9)5-8/h2,4-5,7H,3,9H2,1H3,(H,10,11).
What are the key properties of N-(3-aminocyclohexa-1,5-dien-1-yl)acetamide?
N-(3-aminocyclohexa-1,5-dien-1-yl)acetamide has a molecular weight of 152.20 g/mol, XLogP of 0.29, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-aminocyclohexa-1,5-dien-1-yl)acetamide is sourced from PubChem (CID 18972254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).