C9H7ClF3NO — CID 18972709
3-(2-Amino-5-chlorophenyl)-1,1,1-trifluoropropan-2-one (PubChem CID 18972709) has the molecular formula C9H7ClF3NO and a molecular weight of 237.60 g/mol. Its IUPAC name is 3-(2-amino-5-chlorophenyl)-1,1,1-trifluoropropan-2-one.
| Compound Name | 3-(2-Amino-5-chlorophenyl)-1,1,1-trifluoropropan-2-one |
|---|---|
| PubChem CID | 18972709 |
| Molecular Formula | C9H7ClF3NO |
| Molecular Weight | 237.60 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 3-(2-amino-5-chlorophenyl)-1,1,1-trifluoropropan-2-one |
| SMILES | C1=CC(=C(C=C1Cl)CC(=O)C(F)(F)F)N |
| InChI | InChI=1S/C9H7ClF3NO/c10-6-1-2-7(14)5(3-6)4-8(15)9(11,12)13/h1-3H,4,14H2 |
| InChIKey | OYURARVWTNCEKH-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 43.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | 244 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.60 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|