C15H6Cl2F2N2O3 — CID 18973187
7,8-dichloro-1-(2,4-difluorophenyl)-4-oxo-1,6-naphthyridine-3-carboxylic acid (PubChem CID 18973187) has the molecular formula C15H6Cl2F2N2O3 and a molecular weight of 371.13 g/mol. Its IUPAC name is 7,8-dichloro-1-(2,4-difluorophenyl)-4-oxo-1,6-naphthyridine-3-carboxylic acid.
| Compound Name | 7,8-dichloro-1-(2,4-difluorophenyl)-4-oxo-1,6-naphthyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 18973187 |
| Molecular Formula | C15H6Cl2F2N2O3 |
| Molecular Weight | 371.13 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | 7,8-dichloro-1-(2,4-difluorophenyl)-4-oxo-1,6-naphthyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cn(-c2ccc(F)cc2F)c2c(Cl)c(Cl)ncc2c1=O |
| InChI | InChI=1S/C15H6Cl2F2N2O3/c16-11-12-7(4-20-14(11)17)13(22)8(15(23)24)5-21(12)10-2-1-6(18)3-9(10)19/h1-5H,(H,23,24) |
| InChIKey | HUPVZGNGKMUPJO-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.13 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|