C17H10Cl2F2N2O3 — CID 18973193
ethyl 7,8-dichloro-1-(2,4-difluorophenyl)-4-oxo-1,6-naphthyridine-3-carboxylate (PubChem CID 18973193) has the molecular formula C17H10Cl2F2N2O3 and a molecular weight of 399.18 g/mol. Its IUPAC name is ethyl 7,8-dichloro-1-(2,4-difluorophenyl)-4-oxo-1,6-naphthyridine-3-carboxylate.
| Compound Name | ethyl 7,8-dichloro-1-(2,4-difluorophenyl)-4-oxo-1,6-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 18973193 |
| Molecular Formula | C17H10Cl2F2N2O3 |
| Molecular Weight | 399.18 g/mol |
| Exact Mass | 398.00 |
| IUPAC Name | ethyl 7,8-dichloro-1-(2,4-difluorophenyl)-4-oxo-1,6-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(-c2ccc(F)cc2F)c2c(Cl)c(Cl)ncc2c1=O |
| InChI | InChI=1S/C17H10Cl2F2N2O3/c1-2-26-17(25)10-7-23(12-4-3-8(20)5-11(12)21)14-9(15(10)24)6-22-16(19)13(14)18/h3-7H,2H2,1H3 |
| InChIKey | OQMIYUXIRRWGCI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.18 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|