C19H14F2N2O2S — CID 18973243
4-[[1-[(2,4-difluorophenyl)methyl]indol-4-yl]methyl]-1,3-thiazolidine-2,5-dione (PubChem CID 18973243) has the molecular formula C19H14F2N2O2S and a molecular weight of 372.40 g/mol. Its IUPAC name is 4-[[1-[(2,4-difluorophenyl)methyl]indol-4-yl]methyl]-1,3-thiazolidine-2,5-dione.
| Compound Name | 4-[[1-[(2,4-difluorophenyl)methyl]indol-4-yl]methyl]-1,3-thiazolidine-2,5-dione |
|---|---|
| PubChem CID | 18973243 |
| Molecular Formula | C19H14F2N2O2S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 4-[[1-[(2,4-difluorophenyl)methyl]indol-4-yl]methyl]-1,3-thiazolidine-2,5-dione |
| SMILES | O=C1NC(Cc2cccc3c2ccn3Cc2ccc(F)cc2F)C(=O)S1 |
| InChI | InChI=1S/C19H14F2N2O2S/c20-13-5-4-12(15(21)9-13)10-23-7-6-14-11(2-1-3-17(14)23)8-16-18(24)26-19(25)22-16/h1-7,9,16H,8,10H2,(H,22,25) |
| InChIKey | RYVYZYCDAKSKFF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|