C15H14N2O4S — CID 18973457
3-[4-(3-methyl-2,5-dioxo-1,3-thiazolidin-4-yl)indol-1-yl]propanoic acid (PubChem CID 18973457) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is 3-[4-(3-methyl-2,5-dioxo-1,3-thiazolidin-4-yl)indol-1-yl]propanoic acid.
| Compound Name | 3-[4-(3-methyl-2,5-dioxo-1,3-thiazolidin-4-yl)indol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 18973457 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | 3-[4-(3-methyl-2,5-dioxo-1,3-thiazolidin-4-yl)indol-1-yl]propanoic acid |
| SMILES | CN1C(=O)SC(=O)C1c1cccc2c1ccn2CCC(=O)O |
| InChI | InChI=1S/C15H14N2O4S/c1-16-13(14(20)22-15(16)21)10-3-2-4-11-9(10)5-7-17(11)8-6-12(18)19/h2-5,7,13H,6,8H2,1H3,(H,18,19) |
| InChIKey | ZQPRLBXSWCPJBK-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 79.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|