C10H2F15N3 — CID 18974137
2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,3,5-triazine (PubChem CID 18974137) has the molecular formula C10H2F15N3 and a molecular weight of 449.12 g/mol. Its IUPAC name is 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,3,5-triazine.
| Compound Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 18974137 |
| Molecular Formula | C10H2F15N3 |
| Molecular Weight | 449.12 g/mol |
| Exact Mass | 449.00 |
| IUPAC Name | 2-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptyl)-1,3,5-triazine |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c1ncncn1 |
| InChI | InChI=1S/C10H2F15N3/c11-4(12,3-27-1-26-2-28-3)5(13,14)6(15,16)7(17,18)8(19,20)9(21,22)10(23,24)25/h1-2H |
| InChIKey | IDQQCBZXMXIMDV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.12 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|