C12H27P3 — CID 18974584
[1,4,7-trimethyl-4,7-bis(phosphanyl)cyclononyl]phosphane (PubChem CID 18974584) has the molecular formula C12H27P3 and a molecular weight of 264.27 g/mol. Its IUPAC name is [1,4,7-trimethyl-4,7-bis(phosphanyl)cyclononyl]phosphane.
| Compound Name | [1,4,7-trimethyl-4,7-bis(phosphanyl)cyclononyl]phosphane |
|---|---|
| PubChem CID | 18974584 |
| Molecular Formula | C12H27P3 |
| Molecular Weight | 264.27 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | [1,4,7-trimethyl-4,7-bis(phosphanyl)cyclononyl]phosphane |
| SMILES | CC1(P)CCC(C)(P)CCC(C)(P)CC1 |
| InChI | InChI=1S/C12H27P3/c1-10(13)4-6-11(2,14)8-9-12(3,15)7-5-10/h4-9,13-15H2,1-3H3 |
| InChIKey | FBOOARDCFITDPC-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.27 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|