C16H31N3O — CID 18974677
3-decyl-N,N-dimethyl-2H-imidazole-1-carboxamide (PubChem CID 18974677) has the molecular formula C16H31N3O and a molecular weight of 281.44 g/mol. Its IUPAC name is 3-decyl-N,N-dimethyl-2H-imidazole-1-carboxamide.
| Compound Name | 3-decyl-N,N-dimethyl-2H-imidazole-1-carboxamide |
|---|---|
| PubChem CID | 18974677 |
| Molecular Formula | C16H31N3O |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.25 |
| IUPAC Name | 3-decyl-N,N-dimethyl-2H-imidazole-1-carboxamide |
| SMILES | CCCCCCCCCCN1C=CN(C(=O)N(C)C)C1 |
| InChI | InChI=1S/C16H31N3O/c1-4-5-6-7-8-9-10-11-12-18-13-14-19(15-18)16(20)17(2)3/h13-14H,4-12,15H2,1-3H3 |
| InChIKey | GTVKGDGUAOHJED-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|