About 4-(aminomethyl)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide
4-(aminomethyl)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide (PubChem CID 18974721) has the molecular formula C22H16N2O6
and a molecular weight of 404.38 g/mol. Its IUPAC name is 4-(aminomethyl)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide.
Molecular Properties
| Compound Name | 4-(aminomethyl)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide |
| PubChem CID | 18974721 |
| Molecular Formula | C22H16N2O6 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 4-(aminomethyl)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide |
| SMILES | NCc1c(C(N)=O)ccc2c1C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| InChI | InChI=1S/C22H16N2O6/c23-9-13-12(20(24)27)3-6-16-19(13)21(28)30-22(16)14-4-1-10(25)7-17(14)29-18-8-11(26)2-5-15(18)22/h1-8,25-26H,9,23H2,(H2,24,27) |
| InChIKey | HSNNALYWXNPACN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(aminomethyl)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(aminomethyl)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide?
The IUPAC name of 4-(aminomethyl)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide (CID 18974721) is 4-(aminomethyl)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide.
What is the SMILES notation for 4-(aminomethyl)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide?
The canonical SMILES for 4-(aminomethyl)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide is NCc1c(C(N)=O)ccc2c1C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21.
What is the InChIKey of 4-(aminomethyl)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide?
The InChIKey is HSNNALYWXNPACN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16N2O6/c23-9-13-12(20(24)27)3-6-16-19(13)21(28)30-22(16)14-4-1-10(25)7-17(14)29-18-8-11(26)2-5-15(18)22/h1-8,25-26H,9,23H2,(H2,24,27).
What are the key properties of 4-(aminomethyl)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide?
4-(aminomethyl)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide has a molecular weight of 404.38 g/mol, XLogP of 2.22, 2 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(aminomethyl)-3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-5-carboxamide is sourced from PubChem (CID 18974721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).