C25H29N5 — CID 18975369
3-[3-(4-benzylpiperidin-1-yl)propyl]-5-(1,2,4-triazol-4-yl)-1H-indole (PubChem CID 18975369) has the molecular formula C25H29N5 and a molecular weight of 399.54 g/mol. Its IUPAC name is 3-[3-(4-benzylpiperidin-1-yl)propyl]-5-(1,2,4-triazol-4-yl)-1H-indole.
| Compound Name | 3-[3-(4-benzylpiperidin-1-yl)propyl]-5-(1,2,4-triazol-4-yl)-1H-indole |
|---|---|
| PubChem CID | 18975369 |
| Molecular Formula | C25H29N5 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 3-[3-(4-benzylpiperidin-1-yl)propyl]-5-(1,2,4-triazol-4-yl)-1H-indole |
| SMILES | c1ccc(CC2CCN(CCCc3c[nH]c4ccc(-n5cnnc5)cc34)CC2)cc1 |
| InChI | InChI=1S/C25H29N5/c1-2-5-20(6-3-1)15-21-10-13-29(14-11-21)12-4-7-22-17-26-25-9-8-23(16-24(22)25)30-18-27-28-19-30/h1-3,5-6,8-9,16-19,21,26H,4,7,10-15H2 |
| InChIKey | DGBLGFKUPSZRAW-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |