About N-(diaminomethylidene)-3,4,5-trifluoro-2-phenylbenzamide
N-(diaminomethylidene)-3,4,5-trifluoro-2-phenylbenzamide (PubChem CID 18976404) has the molecular formula C14H10F3N3O
and a molecular weight of 293.25 g/mol. Its IUPAC name is N-(diaminomethylidene)-3,4,5-trifluoro-2-phenylbenzamide.
Molecular Properties
| Compound Name | N-(diaminomethylidene)-3,4,5-trifluoro-2-phenylbenzamide |
| PubChem CID | 18976404 |
| Molecular Formula | C14H10F3N3O |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-(diaminomethylidene)-3,4,5-trifluoro-2-phenylbenzamide |
| SMILES | NC(N)=NC(=O)c1cc(F)c(F)c(F)c1-c1ccccc1 |
| InChI | InChI=1S/C14H10F3N3O/c15-9-6-8(13(21)20-14(18)19)10(12(17)11(9)16)7-4-2-1-3-5-7/h1-6H,(H4,18,19,20,21) |
| InChIKey | AYXBOWFIGSZAGR-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(diaminomethylidene)-3,4,5-trifluoro-2-phenylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(diaminomethylidene)-3,4,5-trifluoro-2-phenylbenzamide?
The IUPAC name of N-(diaminomethylidene)-3,4,5-trifluoro-2-phenylbenzamide (CID 18976404) is N-(diaminomethylidene)-3,4,5-trifluoro-2-phenylbenzamide.
What is the SMILES notation for N-(diaminomethylidene)-3,4,5-trifluoro-2-phenylbenzamide?
The canonical SMILES for N-(diaminomethylidene)-3,4,5-trifluoro-2-phenylbenzamide is NC(N)=NC(=O)c1cc(F)c(F)c(F)c1-c1ccccc1.
What is the InChIKey of N-(diaminomethylidene)-3,4,5-trifluoro-2-phenylbenzamide?
The InChIKey is AYXBOWFIGSZAGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F3N3O/c15-9-6-8(13(21)20-14(18)19)10(12(17)11(9)16)7-4-2-1-3-5-7/h1-6H,(H4,18,19,20,21).
What are the key properties of N-(diaminomethylidene)-3,4,5-trifluoro-2-phenylbenzamide?
N-(diaminomethylidene)-3,4,5-trifluoro-2-phenylbenzamide has a molecular weight of 293.25 g/mol, XLogP of 2.18, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(diaminomethylidene)-3,4,5-trifluoro-2-phenylbenzamide is sourced from PubChem (CID 18976404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).