About 4-methoxy-7,8-dihydronaphthalene-1-carbothialdehyde
4-methoxy-7,8-dihydronaphthalene-1-carbothialdehyde (PubChem CID 18976444) has the molecular formula C12H12OS
and a molecular weight of 204.29 g/mol. Its IUPAC name is 4-methoxy-7,8-dihydronaphthalene-1-carbothialdehyde.
Molecular Properties
| Compound Name | 4-methoxy-7,8-dihydronaphthalene-1-carbothialdehyde |
| PubChem CID | 18976444 |
| Molecular Formula | C12H12OS |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | 4-methoxy-7,8-dihydronaphthalene-1-carbothialdehyde |
| SMILES | COc1ccc(C=S)c2c1C=CCC2 |
| InChI | InChI=1S/C12H12OS/c1-13-12-7-6-9(8-14)10-4-2-3-5-11(10)12/h3,5-8H,2,4H2,1H3 |
| InChIKey | CEMMDPHXRYFVEF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-7,8-dihydronaphthalene-1-carbothialdehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-7,8-dihydronaphthalene-1-carbothialdehyde?
The IUPAC name of 4-methoxy-7,8-dihydronaphthalene-1-carbothialdehyde (CID 18976444) is 4-methoxy-7,8-dihydronaphthalene-1-carbothialdehyde.
What is the SMILES notation for 4-methoxy-7,8-dihydronaphthalene-1-carbothialdehyde?
The canonical SMILES for 4-methoxy-7,8-dihydronaphthalene-1-carbothialdehyde is COc1ccc(C=S)c2c1C=CCC2.
What is the InChIKey of 4-methoxy-7,8-dihydronaphthalene-1-carbothialdehyde?
The InChIKey is CEMMDPHXRYFVEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12OS/c1-13-12-7-6-9(8-14)10-4-2-3-5-11(10)12/h3,5-8H,2,4H2,1H3.
What are the key properties of 4-methoxy-7,8-dihydronaphthalene-1-carbothialdehyde?
4-methoxy-7,8-dihydronaphthalene-1-carbothialdehyde has a molecular weight of 204.29 g/mol, XLogP of 3.00, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-7,8-dihydronaphthalene-1-carbothialdehyde is sourced from PubChem (CID 18976444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).