C32H34F5IOS — CID 18976480
1-iodo-4-[(E)-1-[4-[5-(4,4,5,5,5-pentafluoropentylsulfanyl)pentoxy]phenyl]-2-phenylbut-1-enyl]benzene (PubChem CID 18976480) has the molecular formula C32H34F5IOS and a molecular weight of 688.58 g/mol. Its IUPAC name is 1-iodo-4-[(E)-1-[4-[5-(4,4,5,5,5-pentafluoropentylsulfanyl)pentoxy]phenyl]-2-phenylbut-1-enyl]benzene.
| Compound Name | 1-iodo-4-[(E)-1-[4-[5-(4,4,5,5,5-pentafluoropentylsulfanyl)pentoxy]phenyl]-2-phenylbut-1-enyl]benzene |
|---|---|
| PubChem CID | 18976480 |
| Molecular Formula | C32H34F5IOS |
| Molecular Weight | 688.58 g/mol |
| Exact Mass | 688.13 |
| IUPAC Name | 1-iodo-4-[(E)-1-[4-[5-(4,4,5,5,5-pentafluoropentylsulfanyl)pentoxy]phenyl]-2-phenylbut-1-enyl]benzene |
| SMILES | CC/C(=C(\c1ccc(I)cc1)c1ccc(OCCCCCSCCCC(F)(F)C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C32H34F5IOS/c1-2-29(24-10-5-3-6-11-24)30(25-12-16-27(38)17-13-25)26-14-18-28(19-15-26)39-21-7-4-8-22-40-23-9-20-31(33,34)32(35,36)37/h3,5-6,10-19H,2,4,7-9,20-23H2,1H3/b30-29- |
| InChIKey | FFMHNCRJOUFHSF-FLWNBWAVSA-N |
| XLogP | 10.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.58 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|