C26H31F5O2S — CID 18976516
1-[4-[5-(4,4,5,5,5-pentafluoropentylsulfanyl)pentoxy]phenyl]-2-phenylbutan-1-one (PubChem CID 18976516) has the molecular formula C26H31F5O2S and a molecular weight of 502.59 g/mol. Its IUPAC name is 1-[4-[5-(4,4,5,5,5-pentafluoropentylsulfanyl)pentoxy]phenyl]-2-phenylbutan-1-one.
| Compound Name | 1-[4-[5-(4,4,5,5,5-pentafluoropentylsulfanyl)pentoxy]phenyl]-2-phenylbutan-1-one |
|---|---|
| PubChem CID | 18976516 |
| Molecular Formula | C26H31F5O2S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | 1-[4-[5-(4,4,5,5,5-pentafluoropentylsulfanyl)pentoxy]phenyl]-2-phenylbutan-1-one |
| SMILES | CCC(C(=O)c1ccc(OCCCCCSCCCC(F)(F)C(F)(F)F)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H31F5O2S/c1-2-23(20-10-5-3-6-11-20)24(32)21-12-14-22(15-13-21)33-17-7-4-8-18-34-19-9-16-25(27,28)26(29,30)31/h3,5-6,10-15,23H,2,4,7-9,16-19H2,1H3 |
| InChIKey | JMMLSAMFCAVFCS-UHFFFAOYSA-N |
| XLogP | 8.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|