C16H22O10S — CID 18976665
3-(2,3-dicarboxycyclohexyl)sulfonylcyclohexane-1,2-dicarboxylic acid (PubChem CID 18976665) has the molecular formula C16H22O10S and a molecular weight of 406.41 g/mol. Its IUPAC name is 3-(2,3-dicarboxycyclohexyl)sulfonylcyclohexane-1,2-dicarboxylic acid.
| Compound Name | 3-(2,3-dicarboxycyclohexyl)sulfonylcyclohexane-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 18976665 |
| Molecular Formula | C16H22O10S |
| Molecular Weight | 406.41 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 3-(2,3-dicarboxycyclohexyl)sulfonylcyclohexane-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1CCCC(S(=O)(=O)C2CCCC(C(=O)O)C2C(=O)O)C1C(=O)O |
| InChI | InChI=1S/C16H22O10S/c17-13(18)7-3-1-5-9(11(7)15(21)22)27(25,26)10-6-2-4-8(14(19)20)12(10)16(23)24/h7-12H,1-6H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | RCJRZDXYUKCKHE-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 183.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.41 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |