About 1-methoxypyridin-1-ium;methyl sulfate
1-methoxypyridin-1-ium;methyl sulfate (PubChem CID 18977228) has the molecular formula C7H11NO5S
and a molecular weight of 221.23 g/mol. Its IUPAC name is 1-methoxypyridin-1-ium;methyl sulfate.
Molecular Properties
| Compound Name | 1-methoxypyridin-1-ium;methyl sulfate |
| PubChem CID | 18977228 |
| Molecular Formula | C7H11NO5S |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 1-methoxypyridin-1-ium;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].CO[n+]1ccccc1 |
| InChI | InChI=1S/C6H8NO.CH4O4S/c1-8-7-5-3-2-4-6-7;1-5-6(2,3)4/h2-6H,1H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | VWRDQQLZUFKYFL-UHFFFAOYSA-M |
| XLogP | -0.87 |
| TPSA | 79.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze 1-methoxypyridin-1-ium;methyl sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypyridin-1-ium;methyl sulfate?
The IUPAC name of 1-methoxypyridin-1-ium;methyl sulfate (CID 18977228) is 1-methoxypyridin-1-ium;methyl sulfate.
What is the SMILES notation for 1-methoxypyridin-1-ium;methyl sulfate?
The canonical SMILES for 1-methoxypyridin-1-ium;methyl sulfate is COS(=O)(=O)[O-].CO[n+]1ccccc1.
What is the InChIKey of 1-methoxypyridin-1-ium;methyl sulfate?
The InChIKey is VWRDQQLZUFKYFL-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H8NO.CH4O4S/c1-8-7-5-3-2-4-6-7;1-5-6(2,3)4/h2-6H,1H3;1H3,(H,2,3,4)/q+1;/p-1.
What are the key properties of 1-methoxypyridin-1-ium;methyl sulfate?
1-methoxypyridin-1-ium;methyl sulfate has a molecular weight of 221.23 g/mol, XLogP of -0.87, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypyridin-1-ium;methyl sulfate is sourced from PubChem (CID 18977228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).