C6H6Br2Cl2O2 — CID 18977721
2,2-dibromo-4,4-dichloro-3-ethoxycyclobutan-1-one (PubChem CID 18977721) has the molecular formula C6H6Br2Cl2O2 and a molecular weight of 340.83 g/mol. Its IUPAC name is 2,2-dibromo-4,4-dichloro-3-ethoxycyclobutan-1-one.
| Compound Name | 2,2-dibromo-4,4-dichloro-3-ethoxycyclobutan-1-one |
|---|---|
| PubChem CID | 18977721 |
| Molecular Formula | C6H6Br2Cl2O2 |
| Molecular Weight | 340.83 g/mol |
| Exact Mass | 337.81 |
| IUPAC Name | 2,2-dibromo-4,4-dichloro-3-ethoxycyclobutan-1-one |
| SMILES | CCOC1C(Cl)(Cl)C(=O)C1(Br)Br |
| InChI | InChI=1S/C6H6Br2Cl2O2/c1-2-12-4-5(7,8)3(11)6(4,9)10/h4H,2H2,1H3 |
| InChIKey | OPIYVAPEENXYJO-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.83 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|