C15H14BrNO4S — CID 18977970
2-[4-bromo-2-(methylsulfonylmethyl)benzoyl]-3-cyclopropyl-3-oxopropanenitrile (PubChem CID 18977970) has the molecular formula C15H14BrNO4S and a molecular weight of 384.25 g/mol. Its IUPAC name is 2-[4-bromo-2-(methylsulfonylmethyl)benzoyl]-3-cyclopropyl-3-oxopropanenitrile.
| Compound Name | 2-[4-bromo-2-(methylsulfonylmethyl)benzoyl]-3-cyclopropyl-3-oxopropanenitrile |
|---|---|
| PubChem CID | 18977970 |
| Molecular Formula | C15H14BrNO4S |
| Molecular Weight | 384.25 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | 2-[4-bromo-2-(methylsulfonylmethyl)benzoyl]-3-cyclopropyl-3-oxopropanenitrile |
| SMILES | CS(=O)(=O)Cc1cc(Br)ccc1C(=O)C(C#N)C(=O)C1CC1 |
| InChI | InChI=1S/C15H14BrNO4S/c1-22(20,21)8-10-6-11(16)4-5-12(10)15(19)13(7-17)14(18)9-2-3-9/h4-6,9,13H,2-3,8H2,1H3 |
| InChIKey | CNWMLKALBDBPOI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 92.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|