About 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoic acid
6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoic acid (PubChem CID 18979211) has the molecular formula C12H14N2O2S
and a molecular weight of 250.32 g/mol. Its IUPAC name is 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoic acid.
Molecular Properties
| Compound Name | 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoic acid |
| PubChem CID | 18979211 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoic acid |
| SMILES | O=C(O)CCCCCc1nc2cccnc2s1 |
| InChI | InChI=1S/C12H14N2O2S/c15-11(16)7-3-1-2-6-10-14-9-5-4-8-13-12(9)17-10/h4-5,8H,1-3,6-7H2,(H,15,16) |
| InChIKey | WBIWETGMRFLSOZ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoic acid?
The IUPAC name of 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoic acid (CID 18979211) is 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoic acid.
What is the SMILES notation for 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoic acid?
The canonical SMILES for 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoic acid is O=C(O)CCCCCc1nc2cccnc2s1.
What is the InChIKey of 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoic acid?
The InChIKey is WBIWETGMRFLSOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2S/c15-11(16)7-3-1-2-6-10-14-9-5-4-8-13-12(9)17-10/h4-5,8H,1-3,6-7H2,(H,15,16).
What are the key properties of 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoic acid?
6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoic acid has a molecular weight of 250.32 g/mol, XLogP of 2.88, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoic acid is sourced from PubChem (CID 18979211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).