About ethyl 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoate
ethyl 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoate (PubChem CID 18979254) has the molecular formula C14H18N2O2S
and a molecular weight of 278.38 g/mol. Its IUPAC name is ethyl 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoate.
Molecular Properties
| Compound Name | ethyl 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoate |
| PubChem CID | 18979254 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | ethyl 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoate |
| SMILES | CCOC(=O)CCCCCc1nc2cccnc2s1 |
| InChI | InChI=1S/C14H18N2O2S/c1-2-18-13(17)9-5-3-4-8-12-16-11-7-6-10-15-14(11)19-12/h6-7,10H,2-5,8-9H2,1H3 |
| InChIKey | HVTKVDXBCUHTFQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoate?
The IUPAC name of ethyl 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoate (CID 18979254) is ethyl 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoate.
What is the SMILES notation for ethyl 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoate?
The canonical SMILES for ethyl 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoate is CCOC(=O)CCCCCc1nc2cccnc2s1.
What is the InChIKey of ethyl 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoate?
The InChIKey is HVTKVDXBCUHTFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O2S/c1-2-18-13(17)9-5-3-4-8-12-16-11-7-6-10-15-14(11)19-12/h6-7,10H,2-5,8-9H2,1H3.
What are the key properties of ethyl 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoate?
ethyl 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoate has a molecular weight of 278.38 g/mol, XLogP of 3.36, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-([1,3]thiazolo[5,4-b]pyridin-2-yl)hexanoate is sourced from PubChem (CID 18979254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).