About 3-iminoisoindol-1-amine
3-iminoisoindol-1-amine (PubChem CID 18980) has the molecular formula C8H7N3
and a molecular weight of 145.16 g/mol. Its IUPAC name is 3-iminoisoindol-1-amine.
Molecular Properties
| Compound Name | 3-iminoisoindol-1-amine |
| PubChem CID | 18980 |
| Molecular Formula | C8H7N3 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 3-iminoisoindol-1-amine |
| SMILES | [H]/N=C1\N=C(N)c2ccccc21 |
| InChI | InChI=1S/C8H7N3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-4H,(H3,9,10,11) |
| InChIKey | RZVCEPSDYHAHLX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-iminoisoindol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iminoisoindol-1-amine?
The IUPAC name of 3-iminoisoindol-1-amine (CID 18980) is 3-iminoisoindol-1-amine.
What is the SMILES notation for 3-iminoisoindol-1-amine?
The canonical SMILES for 3-iminoisoindol-1-amine is [H]/N=C1\N=C(N)c2ccccc21.
What is the InChIKey of 3-iminoisoindol-1-amine?
The InChIKey is RZVCEPSDYHAHLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3/c9-7-5-3-1-2-4-6(5)8(10)11-7/h1-4H,(H3,9,10,11).
What are the key properties of 3-iminoisoindol-1-amine?
3-iminoisoindol-1-amine has a molecular weight of 145.16 g/mol, XLogP of 0.73, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iminoisoindol-1-amine is sourced from PubChem (CID 18980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).