C11H7ClINO3 — CID 18980002
8-chloro-4-iodo-3-methoxy-1H-1-benzazepine-2,5-dione (PubChem CID 18980002) has the molecular formula C11H7ClINO3 and a molecular weight of 363.54 g/mol. Its IUPAC name is 8-chloro-4-iodo-3-methoxy-1H-1-benzazepine-2,5-dione.
| Compound Name | 8-chloro-4-iodo-3-methoxy-1H-1-benzazepine-2,5-dione |
|---|---|
| PubChem CID | 18980002 |
| Molecular Formula | C11H7ClINO3 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 362.92 |
| IUPAC Name | 8-chloro-4-iodo-3-methoxy-1H-1-benzazepine-2,5-dione |
| SMILES | COc1c(I)c(=O)c2ccc(Cl)cc2[nH]c1=O |
| InChI | InChI=1S/C11H7ClINO3/c1-17-10-8(13)9(15)6-3-2-5(12)4-7(6)14-11(10)16/h2-4H,1H3,(H,14,16) |
| InChIKey | SHIADPSEHXQSIY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|