C26H40N2O — CID 18980247
(4E,7E,10E,13E,16E,19E)-1-piperazin-1-yldocosa-4,7,10,13,16,19-hexaen-1-one (PubChem CID 18980247) has the molecular formula C26H40N2O and a molecular weight of 396.62 g/mol. Its IUPAC name is (4E,7E,10E,13E,16E,19E)-1-piperazin-1-yldocosa-4,7,10,13,16,19-hexaen-1-one.
| Compound Name | (4E,7E,10E,13E,16E,19E)-1-piperazin-1-yldocosa-4,7,10,13,16,19-hexaen-1-one |
|---|---|
| PubChem CID | 18980247 |
| Molecular Formula | C26H40N2O |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | (4E,7E,10E,13E,16E,19E)-1-piperazin-1-yldocosa-4,7,10,13,16,19-hexaen-1-one |
| SMILES | CC/C=C/C/C=C/C/C=C/C/C=C/C/C=C/C/C=C/CCC(=O)N1CCNCC1 |
| InChI | InChI=1S/C26H40N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-26(29)28-24-22-27-23-25-28/h3-4,6-7,9-10,12-13,15-16,18-19,27H,2,5,8,11,14,17,20-25H2,1H3/b4-3+,7-6+,10-9+,13-12+,16-15+,19-18+ |
| InChIKey | SLYLOHBAXFBFRA-SFGLVEFQSA-N |
| XLogP | 5.90 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|