C10H8F3NO2 — CID 18980588
3-[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 18980588) has the molecular formula C10H8F3NO2 and a molecular weight of 231.17 g/mol. Its IUPAC name is 3-[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 18980588 |
| Molecular Formula | C10H8F3NO2 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 3-[2-(trifluoromethyl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | O=C1OCCN1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C10H8F3NO2/c11-10(12,13)7-3-1-2-4-8(7)14-5-6-16-9(14)15/h1-4H,5-6H2 |
| InChIKey | JNBVUJVGEKYAQQ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |