C13H12ClFN2O — CID 18981048
4-(3-chloro-4,5,6,7-tetrahydroindazol-2-yl)-3-fluorophenol (PubChem CID 18981048) has the molecular formula C13H12ClFN2O and a molecular weight of 266.70 g/mol. Its IUPAC name is 4-(3-chloro-4,5,6,7-tetrahydroindazol-2-yl)-3-fluorophenol.
| Compound Name | 4-(3-chloro-4,5,6,7-tetrahydroindazol-2-yl)-3-fluorophenol |
|---|---|
| PubChem CID | 18981048 |
| Molecular Formula | C13H12ClFN2O |
| Molecular Weight | 266.70 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 4-(3-chloro-4,5,6,7-tetrahydroindazol-2-yl)-3-fluorophenol |
| SMILES | Oc1ccc(-n2nc3c(c2Cl)CCCC3)c(F)c1 |
| InChI | InChI=1S/C13H12ClFN2O/c14-13-9-3-1-2-4-11(9)16-17(13)12-6-5-8(18)7-10(12)15/h5-7,18H,1-4H2 |
| InChIKey | KNIWSQCSROEUEO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.70 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |