C9H18N6O6 — CID 18981593
2-N,2-N,4-N,4-N,6-N,6-N-hexamethoxy-1,3,5-triazine-2,4,6-triamine (PubChem CID 18981593) has the molecular formula C9H18N6O6 and a molecular weight of 306.28 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N,6-N,6-N-hexamethoxy-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexamethoxy-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 18981593 |
| Molecular Formula | C9H18N6O6 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 2-N,2-N,4-N,4-N,6-N,6-N-hexamethoxy-1,3,5-triazine-2,4,6-triamine |
| SMILES | CON(OC)c1nc(N(OC)OC)nc(N(OC)OC)n1 |
| InChI | InChI=1S/C9H18N6O6/c1-16-13(17-2)7-10-8(14(18-3)19-4)12-9(11-7)15(20-5)21-6/h1-6H3 |
| InChIKey | XGJZQNMUVTZITK-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 103.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|