2-ethylpyrazole-3-sulfonyl chloride

C5H7ClN2O2S — CID 18981633

IUPAC2-ethylpyrazole-3-sulfonyl chloride
SMILESCCn1nccc1S(=O)(=O)Cl
InChIInChI=1S/C5H7ClN2O2S/c1-2-8-5(3-4-7-8)11(6,9)10/h3-4H,2H2,1H3
InChIKeyGZCROHZSDGBETQ-UHFFFAOYSA-N
MW194.64 g/mol
LogP0.83
Rot. Bonds2

About 2-ethylpyrazole-3-sulfonyl chloride

2-ethylpyrazole-3-sulfonyl chloride (PubChem CID 18981633) has the molecular formula C5H7ClN2O2S and a molecular weight of 194.64 g/mol. Its IUPAC name is 2-ethylpyrazole-3-sulfonyl chloride.

Molecular Properties

Compound Name2-ethylpyrazole-3-sulfonyl chloride
PubChem CID18981633
Molecular FormulaC5H7ClN2O2S
Molecular Weight194.64 g/mol
Exact Mass193.99
IUPAC Name2-ethylpyrazole-3-sulfonyl chloride
SMILESCCn1nccc1S(=O)(=O)Cl
InChIInChI=1S/C5H7ClN2O2S/c1-2-8-5(3-4-7-8)11(6,9)10/h3-4H,2H2,1H3
InChIKeyGZCROHZSDGBETQ-UHFFFAOYSA-N
XLogP0.83
TPSA51.96 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.64
LogP ≤ 50.83
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze 2-ethylpyrazole-3-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-ethylpyrazole-3-sulfonyl chloride?
The IUPAC name of 2-ethylpyrazole-3-sulfonyl chloride (CID 18981633) is 2-ethylpyrazole-3-sulfonyl chloride.
What is the SMILES notation for 2-ethylpyrazole-3-sulfonyl chloride?
The canonical SMILES for 2-ethylpyrazole-3-sulfonyl chloride is CCn1nccc1S(=O)(=O)Cl.
What is the InChIKey of 2-ethylpyrazole-3-sulfonyl chloride?
The InChIKey is GZCROHZSDGBETQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN2O2S/c1-2-8-5(3-4-7-8)11(6,9)10/h3-4H,2H2,1H3.
What are the key properties of 2-ethylpyrazole-3-sulfonyl chloride?
2-ethylpyrazole-3-sulfonyl chloride has a molecular weight of 194.64 g/mol, XLogP of 0.83, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylpyrazole-3-sulfonyl chloride is sourced from PubChem (CID 18981633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).