About [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl]-(2-fluorophenyl)methanone
[3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl]-(2-fluorophenyl)methanone (PubChem CID 18982031) has the molecular formula C22H26FNO2
and a molecular weight of 355.45 g/mol. Its IUPAC name is [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl]-(2-fluorophenyl)methanone.
Molecular Properties
| Compound Name | [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl]-(2-fluorophenyl)methanone |
| PubChem CID | 18982031 |
| Molecular Formula | C22H26FNO2 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl]-(2-fluorophenyl)methanone |
| SMILES | CCCN(CCC)C1COc2cccc(C(=O)c3ccccc3F)c2C1 |
| InChI | InChI=1S/C22H26FNO2/c1-3-12-24(13-4-2)16-14-19-17(9-7-11-21(19)26-15-16)22(25)18-8-5-6-10-20(18)23/h5-11,16H,3-4,12-15H2,1-2H3 |
| InChIKey | REKJOXDCRJVBCN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl]-(2-fluorophenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl]-(2-fluorophenyl)methanone?
The IUPAC name of [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl]-(2-fluorophenyl)methanone (CID 18982031) is [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl]-(2-fluorophenyl)methanone.
What is the SMILES notation for [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl]-(2-fluorophenyl)methanone?
The canonical SMILES for [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl]-(2-fluorophenyl)methanone is CCCN(CCC)C1COc2cccc(C(=O)c3ccccc3F)c2C1.
What is the InChIKey of [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl]-(2-fluorophenyl)methanone?
The InChIKey is REKJOXDCRJVBCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26FNO2/c1-3-12-24(13-4-2)16-14-19-17(9-7-11-21(19)26-15-16)22(25)18-8-5-6-10-20(18)23/h5-11,16H,3-4,12-15H2,1-2H3.
What are the key properties of [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl]-(2-fluorophenyl)methanone?
[3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl]-(2-fluorophenyl)methanone has a molecular weight of 355.45 g/mol, XLogP of 4.48, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(dipropylamino)-3,4-dihydro-2H-chromen-5-yl]-(2-fluorophenyl)methanone is sourced from PubChem (CID 18982031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).