C22H27N3O — CID 18982056
2-[(1,4-dibenzylpiperazin-2-yl)methyl]-4,5-dihydro-1,3-oxazole (PubChem CID 18982056) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is 2-[(1,4-dibenzylpiperazin-2-yl)methyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-[(1,4-dibenzylpiperazin-2-yl)methyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 18982056 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | 2-[(1,4-dibenzylpiperazin-2-yl)methyl]-4,5-dihydro-1,3-oxazole |
| SMILES | c1ccc(CN2CCN(Cc3ccccc3)C(CC3=NCCO3)C2)cc1 |
| InChI | InChI=1S/C22H27N3O/c1-3-7-19(8-4-1)16-24-12-13-25(17-20-9-5-2-6-10-20)21(18-24)15-22-23-11-14-26-22/h1-10,21H,11-18H2 |
| InChIKey | HONXETXOONSRGV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |