About 2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine
2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine (PubChem CID 18982105) has the molecular formula C9H6N4O2
and a molecular weight of 202.17 g/mol. Its IUPAC name is 2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | 2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine |
| PubChem CID | 18982105 |
| Molecular Formula | C9H6N4O2 |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | 2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine |
| SMILES | Nc1ncnc2oc(-c3ccco3)nc12 |
| InChI | InChI=1S/C9H6N4O2/c10-7-6-9(12-4-11-7)15-8(13-6)5-2-1-3-14-5/h1-4H,(H2,10,11,12) |
| InChIKey | SIJBKFUMHMPIMK-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine?
The IUPAC name of 2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine (CID 18982105) is 2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine.
What is the SMILES notation for 2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine?
The canonical SMILES for 2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine is Nc1ncnc2oc(-c3ccco3)nc12.
What is the InChIKey of 2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine?
The InChIKey is SIJBKFUMHMPIMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N4O2/c10-7-6-9(12-4-11-7)15-8(13-6)5-2-1-3-14-5/h1-4H,(H2,10,11,12).
What are the key properties of 2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine?
2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine has a molecular weight of 202.17 g/mol, XLogP of 1.46, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidin-7-amine is sourced from PubChem (CID 18982105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).