About 7-amino-2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile
7-amino-2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile (PubChem CID 18982122) has the molecular formula C10H5N5O2
and a molecular weight of 227.18 g/mol. Its IUPAC name is 7-amino-2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 7-amino-2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile |
| PubChem CID | 18982122 |
| Molecular Formula | C10H5N5O2 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.04 |
| IUPAC Name | 7-amino-2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile |
| SMILES | N#Cc1nc(N)c2nc(-c3ccco3)oc2n1 |
| InChI | InChI=1S/C10H5N5O2/c11-4-6-13-8(12)7-10(14-6)17-9(15-7)5-2-1-3-16-5/h1-3H,(H2,12,13,14) |
| InChIKey | IYVTVULFRYSZKN-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 114.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-amino-2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-amino-2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile?
The IUPAC name of 7-amino-2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile (CID 18982122) is 7-amino-2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile.
What is the SMILES notation for 7-amino-2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile?
The canonical SMILES for 7-amino-2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile is N#Cc1nc(N)c2nc(-c3ccco3)oc2n1.
What is the InChIKey of 7-amino-2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile?
The InChIKey is IYVTVULFRYSZKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5N5O2/c11-4-6-13-8(12)7-10(14-6)17-9(15-7)5-2-1-3-16-5/h1-3H,(H2,12,13,14).
What are the key properties of 7-amino-2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile?
7-amino-2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile has a molecular weight of 227.18 g/mol, XLogP of 1.33, 1 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-2-(furan-2-yl)-[1,3]oxazolo[5,4-d]pyrimidine-5-carbonitrile is sourced from PubChem (CID 18982122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).