About CID 18982406
CID 18982406 (PubChem CID 18982406) has the molecular formula C19H17BF4OS
and a molecular weight of 380.22 g/mol.
Molecular Properties
| Compound Name | CID 18982406 |
| PubChem CID | 18982406 |
| Molecular Formula | C19H17BF4OS |
| Molecular Weight | 380.22 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | — |
| SMILES | F[B-](F)(F)F.O=[S+](Cc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17OS.BF4/c20-21(18-12-6-2-7-13-18,19-14-8-3-9-15-19)16-17-10-4-1-5-11-17;2-1(3,4)5/h1-15H,16H2;/q+1;-1 |
| InChIKey | LLIRWELXIOFMQU-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 380.22 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 18982406 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 18982406?
The IUPAC name of CID 18982406 (CID 18982406) is not available.
What is the SMILES notation for CID 18982406?
The canonical SMILES for CID 18982406 is F[B-](F)(F)F.O=[S+](Cc1ccccc1)(c1ccccc1)c1ccccc1.
What is the InChIKey of CID 18982406?
The InChIKey is LLIRWELXIOFMQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17OS.BF4/c20-21(18-12-6-2-7-13-18,19-14-8-3-9-15-19)16-17-10-4-1-5-11-17;2-1(3,4)5/h1-15H,16H2;/q+1;-1.
What are the key properties of CID 18982406?
CID 18982406 has a molecular weight of 380.22 g/mol, XLogP of 6.10, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 18982406 is sourced from PubChem (CID 18982406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).