C8H15N3 — CID 18982940
2,3,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-2-ylmethanamine (PubChem CID 18982940) has the molecular formula C8H15N3 and a molecular weight of 153.23 g/mol. Its IUPAC name is 2,3,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-2-ylmethanamine.
| Compound Name | 2,3,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-2-ylmethanamine |
|---|---|
| PubChem CID | 18982940 |
| Molecular Formula | C8H15N3 |
| Molecular Weight | 153.23 g/mol |
| Exact Mass | 153.13 |
| IUPAC Name | 2,3,5,6,7,7a-hexahydro-1H-pyrrolo[3,4-b]pyridin-2-ylmethanamine |
| SMILES | NCC1CC=C2CNCC2N1 |
| InChI | InChI=1S/C8H15N3/c9-3-7-2-1-6-4-10-5-8(6)11-7/h1,7-8,10-11H,2-5,9H2 |
| InChIKey | QJQMTFUSNKVCEM-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.23 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|