About 3-butan-2-yl-3-methyl-2,4-dihydropyrrol-5-amine
3-butan-2-yl-3-methyl-2,4-dihydropyrrol-5-amine (PubChem CID 18983423) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 3-butan-2-yl-3-methyl-2,4-dihydropyrrol-5-amine.
Molecular Properties
| Compound Name | 3-butan-2-yl-3-methyl-2,4-dihydropyrrol-5-amine |
| PubChem CID | 18983423 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 3-butan-2-yl-3-methyl-2,4-dihydropyrrol-5-amine |
| SMILES | CCC(C)C1(C)CN=C(N)C1 |
| InChI | InChI=1S/C9H18N2/c1-4-7(2)9(3)5-8(10)11-6-9/h7H,4-6H2,1-3H3,(H2,10,11) |
| InChIKey | YTNCWNYUYIUHHC-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butan-2-yl-3-methyl-2,4-dihydropyrrol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yl-3-methyl-2,4-dihydropyrrol-5-amine?
The IUPAC name of 3-butan-2-yl-3-methyl-2,4-dihydropyrrol-5-amine (CID 18983423) is 3-butan-2-yl-3-methyl-2,4-dihydropyrrol-5-amine.
What is the SMILES notation for 3-butan-2-yl-3-methyl-2,4-dihydropyrrol-5-amine?
The canonical SMILES for 3-butan-2-yl-3-methyl-2,4-dihydropyrrol-5-amine is CCC(C)C1(C)CN=C(N)C1.
What is the InChIKey of 3-butan-2-yl-3-methyl-2,4-dihydropyrrol-5-amine?
The InChIKey is YTNCWNYUYIUHHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-4-7(2)9(3)5-8(10)11-6-9/h7H,4-6H2,1-3H3,(H2,10,11).
What are the key properties of 3-butan-2-yl-3-methyl-2,4-dihydropyrrol-5-amine?
3-butan-2-yl-3-methyl-2,4-dihydropyrrol-5-amine has a molecular weight of 154.26 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yl-3-methyl-2,4-dihydropyrrol-5-amine is sourced from PubChem (CID 18983423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).