About (5-bromo-1,1-diethyl-3,4-diphenylsilol-2-yl)-trimethylsilane
(5-bromo-1,1-diethyl-3,4-diphenylsilol-2-yl)-trimethylsilane (PubChem CID 18983483) has the molecular formula C23H29BrSi2
and a molecular weight of 441.56 g/mol. Its IUPAC name is (5-bromo-1,1-diethyl-3,4-diphenylsilol-2-yl)-trimethylsilane.
Molecular Properties
| Compound Name | (5-bromo-1,1-diethyl-3,4-diphenylsilol-2-yl)-trimethylsilane |
| PubChem CID | 18983483 |
| Molecular Formula | C23H29BrSi2 |
| Molecular Weight | 441.56 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | (5-bromo-1,1-diethyl-3,4-diphenylsilol-2-yl)-trimethylsilane |
| SMILES | CC[Si]1(CC)C(Br)=C(c2ccccc2)C(c2ccccc2)=C1[Si](C)(C)C |
| InChI | InChI=1S/C23H29BrSi2/c1-6-26(7-2)22(24)20(18-14-10-8-11-15-18)21(23(26)25(3,4)5)19-16-12-9-13-17-19/h8-17H,6-7H2,1-5H3 |
| InChIKey | XRBRXUJMVLNGJS-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.56 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (5-bromo-1,1-diethyl-3,4-diphenylsilol-2-yl)-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromo-1,1-diethyl-3,4-diphenylsilol-2-yl)-trimethylsilane?
The IUPAC name of (5-bromo-1,1-diethyl-3,4-diphenylsilol-2-yl)-trimethylsilane (CID 18983483) is (5-bromo-1,1-diethyl-3,4-diphenylsilol-2-yl)-trimethylsilane.
What is the SMILES notation for (5-bromo-1,1-diethyl-3,4-diphenylsilol-2-yl)-trimethylsilane?
The canonical SMILES for (5-bromo-1,1-diethyl-3,4-diphenylsilol-2-yl)-trimethylsilane is CC[Si]1(CC)C(Br)=C(c2ccccc2)C(c2ccccc2)=C1[Si](C)(C)C.
What is the InChIKey of (5-bromo-1,1-diethyl-3,4-diphenylsilol-2-yl)-trimethylsilane?
The InChIKey is XRBRXUJMVLNGJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H29BrSi2/c1-6-26(7-2)22(24)20(18-14-10-8-11-15-18)21(23(26)25(3,4)5)19-16-12-9-13-17-19/h8-17H,6-7H2,1-5H3.
What are the key properties of (5-bromo-1,1-diethyl-3,4-diphenylsilol-2-yl)-trimethylsilane?
(5-bromo-1,1-diethyl-3,4-diphenylsilol-2-yl)-trimethylsilane has a molecular weight of 441.56 g/mol, XLogP of 7.70, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromo-1,1-diethyl-3,4-diphenylsilol-2-yl)-trimethylsilane is sourced from PubChem (CID 18983483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).