C14H20ClN — CID 18983551
3-chloro-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine (PubChem CID 18983551) has the molecular formula C14H20ClN and a molecular weight of 237.77 g/mol. Its IUPAC name is 3-chloro-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine.
| Compound Name | 3-chloro-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine |
|---|---|
| PubChem CID | 18983551 |
| Molecular Formula | C14H20ClN |
| Molecular Weight | 237.77 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 3-chloro-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-amine |
| SMILES | CC1(C)CCC(C)(C)c2cc(Cl)c(N)cc21 |
| InChI | InChI=1S/C14H20ClN/c1-13(2)5-6-14(3,4)10-8-12(16)11(15)7-9(10)13/h7-8H,5-6,16H2,1-4H3 |
| InChIKey | NPIBGJQKCQIGKK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.77 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|