C14H21N — CID 18983557
1,1,2,3-tetramethyl-3,4-dihydronaphthalen-2-amine (PubChem CID 18983557) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is 1,1,2,3-tetramethyl-3,4-dihydronaphthalen-2-amine.
| Compound Name | 1,1,2,3-tetramethyl-3,4-dihydronaphthalen-2-amine |
|---|---|
| PubChem CID | 18983557 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 1,1,2,3-tetramethyl-3,4-dihydronaphthalen-2-amine |
| SMILES | CC1Cc2ccccc2C(C)(C)C1(C)N |
| InChI | InChI=1S/C14H21N/c1-10-9-11-7-5-6-8-12(11)13(2,3)14(10,4)15/h5-8,10H,9,15H2,1-4H3 |
| InChIKey | QNJZVFCNLZEQBK-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |