About N,2-dimethylprop-2-enamide;N-ethylprop-2-enamide
N,2-dimethylprop-2-enamide;N-ethylprop-2-enamide (PubChem CID 18984068) has the molecular formula C10H18N2O2
and a molecular weight of 198.27 g/mol. Its IUPAC name is N,2-dimethylprop-2-enamide;N-ethylprop-2-enamide.
Molecular Properties
| Compound Name | N,2-dimethylprop-2-enamide;N-ethylprop-2-enamide |
| PubChem CID | 18984068 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | N,2-dimethylprop-2-enamide;N-ethylprop-2-enamide |
| SMILES | C=C(C)C(=O)NC.C=CC(=O)NCC |
| InChI | InChI=1S/2C5H9NO/c1-4(2)5(7)6-3;1-3-5(7)6-4-2/h1H2,2-3H3,(H,6,7);3H,1,4H2,2H3,(H,6,7) |
| InChIKey | SCXDNUOUBKXGEZ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N,2-dimethylprop-2-enamide;N-ethylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethylprop-2-enamide;N-ethylprop-2-enamide?
The IUPAC name of N,2-dimethylprop-2-enamide;N-ethylprop-2-enamide (CID 18984068) is N,2-dimethylprop-2-enamide;N-ethylprop-2-enamide.
What is the SMILES notation for N,2-dimethylprop-2-enamide;N-ethylprop-2-enamide?
The canonical SMILES for N,2-dimethylprop-2-enamide;N-ethylprop-2-enamide is C=C(C)C(=O)NC.C=CC(=O)NCC.
What is the InChIKey of N,2-dimethylprop-2-enamide;N-ethylprop-2-enamide?
The InChIKey is SCXDNUOUBKXGEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H9NO/c1-4(2)5(7)6-3;1-3-5(7)6-4-2/h1H2,2-3H3,(H,6,7);3H,1,4H2,2H3,(H,6,7).
What are the key properties of N,2-dimethylprop-2-enamide;N-ethylprop-2-enamide?
N,2-dimethylprop-2-enamide;N-ethylprop-2-enamide has a molecular weight of 198.27 g/mol, XLogP of 0.62, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethylprop-2-enamide;N-ethylprop-2-enamide is sourced from PubChem (CID 18984068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).