C28H29ClN2O5S — CID 18984420
(E)-but-2-enedioic acid;1-[3-(4-chlorophenyl)-2,3-dihydrobenzo[f][1,4]benzothiazin-1-yl]-2-(diethylamino)ethanone (PubChem CID 18984420) has the molecular formula C28H29ClN2O5S and a molecular weight of 541.07 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;1-[3-(4-chlorophenyl)-2,3-dihydrobenzo[f][1,4]benzothiazin-1-yl]-2-(diethylamino)ethanone.
| Compound Name | (E)-but-2-enedioic acid;1-[3-(4-chlorophenyl)-2,3-dihydrobenzo[f][1,4]benzothiazin-1-yl]-2-(diethylamino)ethanone |
|---|---|
| PubChem CID | 18984420 |
| Molecular Formula | C28H29ClN2O5S |
| Molecular Weight | 541.07 g/mol |
| Exact Mass | 540.15 |
| IUPAC Name | (E)-but-2-enedioic acid;1-[3-(4-chlorophenyl)-2,3-dihydrobenzo[f][1,4]benzothiazin-1-yl]-2-(diethylamino)ethanone |
| SMILES | CCN(CC)CC(=O)N1CC(c2ccc(Cl)cc2)Sc2ccc3ccccc3c21.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C24H25ClN2OS.C4H4O4/c1-3-26(4-2)16-23(28)27-15-22(18-9-12-19(25)13-10-18)29-21-14-11-17-7-5-6-8-20(17)24(21)27;5-3(6)1-2-4(7)8/h5-14,22H,3-4,15-16H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | CUIPQTKLEQAFOR-WLHGVMLRSA-N |
| XLogP | 5.73 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.07 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|