C10H12N2 — CID 18985
3-(2,3,4,5-tetrahydropyridin-6-yl)pyridine (PubChem CID 18985) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 3-(2,3,4,5-tetrahydropyridin-6-yl)pyridine.
| Compound Name | 3-(2,3,4,5-tetrahydropyridin-6-yl)pyridine |
|---|---|
| PubChem CID | 18985 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 3-(2,3,4,5-tetrahydropyridin-6-yl)pyridine |
| SMILES | c1cncc(C2=NCCCC2)c1 |
| InChI | InChI=1S/C10H12N2/c1-2-7-12-10(5-1)9-4-3-6-11-8-9/h3-4,6,8H,1-2,5,7H2 |
| InChIKey | AUBPMADJYNSPOA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |