C19H18O7S — CID 18985070
2-[[1-(benzenesulfonyloxy)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]oxy]acetic acid (PubChem CID 18985070) has the molecular formula C19H18O7S and a molecular weight of 390.41 g/mol. Its IUPAC name is 2-[[1-(benzenesulfonyloxy)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]oxy]acetic acid.
| Compound Name | 2-[[1-(benzenesulfonyloxy)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]oxy]acetic acid |
|---|---|
| PubChem CID | 18985070 |
| Molecular Formula | C19H18O7S |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 2-[[1-(benzenesulfonyloxy)-2,3,3a,8b-tetrahydro-1H-cyclopenta[b][1]benzofuran-5-yl]oxy]acetic acid |
| SMILES | O=C(O)COc1cccc2c1OC1CCC(OS(=O)(=O)c3ccccc3)C21 |
| InChI | InChI=1S/C19H18O7S/c20-17(21)11-24-16-8-4-7-13-18-14(25-19(13)16)9-10-15(18)26-27(22,23)12-5-2-1-3-6-12/h1-8,14-15,18H,9-11H2,(H,20,21) |
| InChIKey | PADMXSPOXKCZIP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|