C12H18ClNO — CID 18985091
2,2,4,6-tetramethyl-3H-1-benzofuran-7-amine;hydrochloride (PubChem CID 18985091) has the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. Its IUPAC name is 2,2,4,6-tetramethyl-3H-1-benzofuran-7-amine;hydrochloride.
| Compound Name | 2,2,4,6-tetramethyl-3H-1-benzofuran-7-amine;hydrochloride |
|---|---|
| PubChem CID | 18985091 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.73 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2,2,4,6-tetramethyl-3H-1-benzofuran-7-amine;hydrochloride |
| SMILES | Cc1cc(C)c2c(c1N)OC(C)(C)C2.Cl |
| InChI | InChI=1S/C12H17NO.ClH/c1-7-5-8(2)10(13)11-9(7)6-12(3,4)14-11;/h5H,6,13H2,1-4H3;1H |
| InChIKey | PCMXMMBGUFEKOI-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.73 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|