About 1-(4-benzylphenyl)sulfanyl-1-[tert-butyl(diphenyl)silyl]butane-1,3-diol
1-(4-benzylphenyl)sulfanyl-1-[tert-butyl(diphenyl)silyl]butane-1,3-diol (PubChem CID 18985108) has the molecular formula C33H38O2SSi
and a molecular weight of 526.82 g/mol. Its IUPAC name is 1-(4-benzylphenyl)sulfanyl-1-[tert-butyl(diphenyl)silyl]butane-1,3-diol.
Molecular Properties
| Compound Name | 1-(4-benzylphenyl)sulfanyl-1-[tert-butyl(diphenyl)silyl]butane-1,3-diol |
| PubChem CID | 18985108 |
| Molecular Formula | C33H38O2SSi |
| Molecular Weight | 526.82 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | 1-(4-benzylphenyl)sulfanyl-1-[tert-butyl(diphenyl)silyl]butane-1,3-diol |
| SMILES | CC(O)CC(O)(Sc1ccc(Cc2ccccc2)cc1)[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H38O2SSi/c1-26(34)25-33(35,36-29-22-20-28(21-23-29)24-27-14-8-5-9-15-27)37(32(2,3)4,30-16-10-6-11-17-30)31-18-12-7-13-19-31/h5-23,26,34-35H,24-25H2,1-4H3 |
| InChIKey | GNKBVCXDSMFRBQ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.82 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-benzylphenyl)sulfanyl-1-[tert-butyl(diphenyl)silyl]butane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-benzylphenyl)sulfanyl-1-[tert-butyl(diphenyl)silyl]butane-1,3-diol?
The IUPAC name of 1-(4-benzylphenyl)sulfanyl-1-[tert-butyl(diphenyl)silyl]butane-1,3-diol (CID 18985108) is 1-(4-benzylphenyl)sulfanyl-1-[tert-butyl(diphenyl)silyl]butane-1,3-diol.
What is the SMILES notation for 1-(4-benzylphenyl)sulfanyl-1-[tert-butyl(diphenyl)silyl]butane-1,3-diol?
The canonical SMILES for 1-(4-benzylphenyl)sulfanyl-1-[tert-butyl(diphenyl)silyl]butane-1,3-diol is CC(O)CC(O)(Sc1ccc(Cc2ccccc2)cc1)[Si](c1ccccc1)(c1ccccc1)C(C)(C)C.
What is the InChIKey of 1-(4-benzylphenyl)sulfanyl-1-[tert-butyl(diphenyl)silyl]butane-1,3-diol?
The InChIKey is GNKBVCXDSMFRBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H38O2SSi/c1-26(34)25-33(35,36-29-22-20-28(21-23-29)24-27-14-8-5-9-15-27)37(32(2,3)4,30-16-10-6-11-17-30)31-18-12-7-13-19-31/h5-23,26,34-35H,24-25H2,1-4H3.
What are the key properties of 1-(4-benzylphenyl)sulfanyl-1-[tert-butyl(diphenyl)silyl]butane-1,3-diol?
1-(4-benzylphenyl)sulfanyl-1-[tert-butyl(diphenyl)silyl]butane-1,3-diol has a molecular weight of 526.82 g/mol, XLogP of 6.43, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-benzylphenyl)sulfanyl-1-[tert-butyl(diphenyl)silyl]butane-1,3-diol is sourced from PubChem (CID 18985108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).