C23H23N5O2 — CID 18985260
benzyl 4-[3-(2,4-diamino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)propyl]benzoate (PubChem CID 18985260) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is benzyl 4-[3-(2,4-diamino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)propyl]benzoate.
| Compound Name | benzyl 4-[3-(2,4-diamino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)propyl]benzoate |
|---|---|
| PubChem CID | 18985260 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | benzyl 4-[3-(2,4-diamino-7H-pyrrolo[2,3-d]pyrimidin-5-yl)propyl]benzoate |
| SMILES | Nc1nc(N)c2c(CCCc3ccc(C(=O)OCc4ccccc4)cc3)c[nH]c2n1 |
| InChI | InChI=1S/C23H23N5O2/c24-20-19-18(13-26-21(19)28-23(25)27-20)8-4-7-15-9-11-17(12-10-15)22(29)30-14-16-5-2-1-3-6-16/h1-3,5-6,9-13H,4,7-8,14H2,(H5,24,25,26,27,28) |
| InChIKey | AZMKENQDBDLPGE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |